C14H21NO4 — CID 115123071
4-[(4-ethoxyphenyl)methyl-methylamino]-3-hydroxybutanoic acid (PubChem CID 115123071) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)methyl-methylamino]-3-hydroxybutanoic acid.
| Compound Name | 4-[(4-ethoxyphenyl)methyl-methylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 115123071 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[(4-ethoxyphenyl)methyl-methylamino]-3-hydroxybutanoic acid |
| SMILES | CCOc1ccc(CN(C)CC(O)CC(=O)O)cc1 |
| InChI | InChI=1S/C14H21NO4/c1-3-19-13-6-4-11(5-7-13)9-15(2)10-12(16)8-14(17)18/h4-7,12,16H,3,8-10H2,1-2H3,(H,17,18) |
| InChIKey | XAZQXZBIYCPQSJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |