C12H12BrFN2S — CID 115123916
4-N-[(5-bromothiophen-2-yl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine (PubChem CID 115123916) has the molecular formula C12H12BrFN2S and a molecular weight of 315.21 g/mol. Its IUPAC name is 4-N-[(5-bromothiophen-2-yl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[(5-bromothiophen-2-yl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115123916 |
| Molecular Formula | C12H12BrFN2S |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 4-N-[(5-bromothiophen-2-yl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine |
| SMILES | CN(Cc1ccc(Br)s1)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C12H12BrFN2S/c1-16(7-9-3-5-12(13)17-9)8-2-4-11(15)10(14)6-8/h2-6H,7,15H2,1H3 |
| InChIKey | GWYNDDNFVZHQIN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|