C14H17BrN2S — CID 115126441
2-N-[2-(5-bromothiophen-2-yl)ethyl]-2-N,4-dimethylbenzene-1,2-diamine (PubChem CID 115126441) has the molecular formula C14H17BrN2S and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-N-[2-(5-bromothiophen-2-yl)ethyl]-2-N,4-dimethylbenzene-1,2-diamine.
| Compound Name | 2-N-[2-(5-bromothiophen-2-yl)ethyl]-2-N,4-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115126441 |
| Molecular Formula | C14H17BrN2S |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-N-[2-(5-bromothiophen-2-yl)ethyl]-2-N,4-dimethylbenzene-1,2-diamine |
| SMILES | Cc1ccc(N)c(N(C)CCc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C14H17BrN2S/c1-10-3-5-12(16)13(9-10)17(2)8-7-11-4-6-14(15)18-11/h3-6,9H,7-8,16H2,1-2H3 |
| InChIKey | JVKLYPQMACGRHQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|