C14H14BrFN2 — CID 115123939
4-N-[(2-bromophenyl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine (PubChem CID 115123939) has the molecular formula C14H14BrFN2 and a molecular weight of 309.18 g/mol. Its IUPAC name is 4-N-[(2-bromophenyl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[(2-bromophenyl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115123939 |
| Molecular Formula | C14H14BrFN2 |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 4-N-[(2-bromophenyl)methyl]-2-fluoro-4-N-methylbenzene-1,4-diamine |
| SMILES | CN(Cc1ccccc1Br)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C14H14BrFN2/c1-18(9-10-4-2-3-5-12(10)15)11-6-7-14(17)13(16)8-11/h2-8H,9,17H2,1H3 |
| InChIKey | AWRZNIAUHXQPKN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|