C13H16FN3 — CID 115124214
4-fluoro-2-N-methyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]benzene-1,2-diamine (PubChem CID 115124214) has the molecular formula C13H16FN3 and a molecular weight of 233.29 g/mol. Its IUPAC name is 4-fluoro-2-N-methyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-2-N-methyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115124214 |
| Molecular Formula | C13H16FN3 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 4-fluoro-2-N-methyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]benzene-1,2-diamine |
| SMILES | CN(CCc1ccc[nH]1)c1cc(F)ccc1N |
| InChI | InChI=1S/C13H16FN3/c1-17(8-6-11-3-2-7-16-11)13-9-10(14)4-5-12(13)15/h2-5,7,9,16H,6,8,15H2,1H3 |
| InChIKey | RLSRHTZABRAQEB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|