C16H18N4 — CID 115125011
1-N,4-dimethyl-1-N-(2-methyl-3H-benzimidazol-5-yl)benzene-1,2-diamine (PubChem CID 115125011) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 1-N,4-dimethyl-1-N-(2-methyl-3H-benzimidazol-5-yl)benzene-1,2-diamine.
| Compound Name | 1-N,4-dimethyl-1-N-(2-methyl-3H-benzimidazol-5-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115125011 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-N,4-dimethyl-1-N-(2-methyl-3H-benzimidazol-5-yl)benzene-1,2-diamine |
| SMILES | Cc1ccc(N(C)c2ccc3nc(C)[nH]c3c2)c(N)c1 |
| InChI | InChI=1S/C16H18N4/c1-10-4-7-16(13(17)8-10)20(3)12-5-6-14-15(9-12)19-11(2)18-14/h4-9H,17H2,1-3H3,(H,18,19) |
| InChIKey | WMKHYMZHUMOXKV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|