C10H8BrClN2S — CID 115125196
1-N-(5-bromothiophen-2-yl)-4-chlorobenzene-1,2-diamine (PubChem CID 115125196) has the molecular formula C10H8BrClN2S and a molecular weight of 303.61 g/mol. Its IUPAC name is 1-N-(5-bromothiophen-2-yl)-4-chlorobenzene-1,2-diamine.
| Compound Name | 1-N-(5-bromothiophen-2-yl)-4-chlorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115125196 |
| Molecular Formula | C10H8BrClN2S |
| Molecular Weight | 303.61 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | 1-N-(5-bromothiophen-2-yl)-4-chlorobenzene-1,2-diamine |
| SMILES | Nc1cc(Cl)ccc1Nc1ccc(Br)s1 |
| InChI | InChI=1S/C10H8BrClN2S/c11-9-3-4-10(15-9)14-8-2-1-6(12)5-7(8)13/h1-5,14H,13H2 |
| InChIKey | XVJYYDMMVZGQEL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|