C14H18ClN3 — CID 115125277
4-chloro-1-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]benzene-1,2-diamine (PubChem CID 115125277) has the molecular formula C14H18ClN3 and a molecular weight of 263.77 g/mol. Its IUPAC name is 4-chloro-1-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-1-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115125277 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-chloro-1-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]benzene-1,2-diamine |
| SMILES | CC(C)(CNc1ccc(Cl)cc1N)c1ccc[nH]1 |
| InChI | InChI=1S/C14H18ClN3/c1-14(2,13-4-3-7-17-13)9-18-12-6-5-10(15)8-11(12)16/h3-8,17-18H,9,16H2,1-2H3 |
| InChIKey | SOONIISJHLMXIC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|