C14H11FN2S — CID 115125641
2-N-(1-benzothiophen-3-yl)-3-fluorobenzene-1,2-diamine (PubChem CID 115125641) has the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-N-(1-benzothiophen-3-yl)-3-fluorobenzene-1,2-diamine.
| Compound Name | 2-N-(1-benzothiophen-3-yl)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115125641 |
| Molecular Formula | C14H11FN2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-N-(1-benzothiophen-3-yl)-3-fluorobenzene-1,2-diamine |
| SMILES | Nc1cccc(F)c1Nc1csc2ccccc12 |
| InChI | InChI=1S/C14H11FN2S/c15-10-5-3-6-11(16)14(10)17-12-8-18-13-7-2-1-4-9(12)13/h1-8,17H,16H2 |
| InChIKey | HJVKWHFCJJCAIV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|