C11H11ClN2O — CID 115126889
3-chloro-2-N-(5-methylfuran-2-yl)benzene-1,2-diamine (PubChem CID 115126889) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 3-chloro-2-N-(5-methylfuran-2-yl)benzene-1,2-diamine.
| Compound Name | 3-chloro-2-N-(5-methylfuran-2-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115126889 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-chloro-2-N-(5-methylfuran-2-yl)benzene-1,2-diamine |
| SMILES | Cc1ccc(Nc2c(N)cccc2Cl)o1 |
| InChI | InChI=1S/C11H11ClN2O/c1-7-5-6-10(15-7)14-11-8(12)3-2-4-9(11)13/h2-6,14H,13H2,1H3 |
| InChIKey | VQNYXPCHJJZKQD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|