C12H12FN3 — CID 115127058
3-fluoro-1-N-methyl-1-N-pyridin-4-ylbenzene-1,2-diamine (PubChem CID 115127058) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is 3-fluoro-1-N-methyl-1-N-pyridin-4-ylbenzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-methyl-1-N-pyridin-4-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115127058 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-fluoro-1-N-methyl-1-N-pyridin-4-ylbenzene-1,2-diamine |
| SMILES | CN(c1ccncc1)c1cccc(F)c1N |
| InChI | InChI=1S/C12H12FN3/c1-16(9-5-7-15-8-6-9)11-4-2-3-10(13)12(11)14/h2-8H,14H2,1H3 |
| InChIKey | YVFSMCLGYLOJGB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|