C13H12BrFN2 — CID 115127062
1-N-(2-bromophenyl)-3-fluoro-1-N-methylbenzene-1,2-diamine (PubChem CID 115127062) has the molecular formula C13H12BrFN2 and a molecular weight of 295.16 g/mol. Its IUPAC name is 1-N-(2-bromophenyl)-3-fluoro-1-N-methylbenzene-1,2-diamine.
| Compound Name | 1-N-(2-bromophenyl)-3-fluoro-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115127062 |
| Molecular Formula | C13H12BrFN2 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 1-N-(2-bromophenyl)-3-fluoro-1-N-methylbenzene-1,2-diamine |
| SMILES | CN(c1ccccc1Br)c1cccc(F)c1N |
| InChI | InChI=1S/C13H12BrFN2/c1-17(11-7-3-2-5-9(11)14)12-8-4-6-10(15)13(12)16/h2-8H,16H2,1H3 |
| InChIKey | ZNNDGIVPATVJBB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|