About 2-bromo-6-fluoroaniline;dihydrofluoride
2-bromo-6-fluoroaniline;dihydrofluoride (PubChem CID 174694012) has the molecular formula C6H7BrF3N
and a molecular weight of 230.03 g/mol. Its IUPAC name is 2-bromo-6-fluoroaniline;dihydrofluoride.
Molecular Properties
| Compound Name | 2-bromo-6-fluoroaniline;dihydrofluoride |
| PubChem CID | 174694012 |
| Molecular Formula | C6H7BrF3N |
| Molecular Weight | 230.03 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 2-bromo-6-fluoroaniline;dihydrofluoride |
| SMILES | F.F.Nc1c(F)cccc1Br |
| InChI | InChI=1S/C6H5BrFN.2FH/c7-4-2-1-3-5(8)6(4)9;;/h1-3H,9H2;2*1H |
| InChIKey | AHBTWVSEVAUYHC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.03 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-fluoroaniline;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-fluoroaniline;dihydrofluoride?
The IUPAC name of 2-bromo-6-fluoroaniline;dihydrofluoride (CID 174694012) is 2-bromo-6-fluoroaniline;dihydrofluoride.
What is the SMILES notation for 2-bromo-6-fluoroaniline;dihydrofluoride?
The canonical SMILES for 2-bromo-6-fluoroaniline;dihydrofluoride is F.F.Nc1c(F)cccc1Br.
What is the InChIKey of 2-bromo-6-fluoroaniline;dihydrofluoride?
The InChIKey is AHBTWVSEVAUYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrFN.2FH/c7-4-2-1-3-5(8)6(4)9;;/h1-3H,9H2;2*1H.
What are the key properties of 2-bromo-6-fluoroaniline;dihydrofluoride?
2-bromo-6-fluoroaniline;dihydrofluoride has a molecular weight of 230.03 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-fluoroaniline;dihydrofluoride is sourced from PubChem (CID 174694012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).