C24H30IN2+ — CID 11512739
(1R,3R,5R,7R)-5-(iodomethyl)-2,6-bis[(1S)-1-phenylethyl]-2-aza-6-azoniatricyclo[4.2.1.03,7]nonane (PubChem CID 11512739) has the molecular formula C24H30IN2+ and a molecular weight of 473.42 g/mol. Its IUPAC name is (1R,3R,5R,7R)-5-(iodomethyl)-2,6-bis[(1S)-1-phenylethyl]-2-aza-6-azoniatricyclo[4.2.1.03,7]nonane.
| Compound Name | (1R,3R,5R,7R)-5-(iodomethyl)-2,6-bis[(1S)-1-phenylethyl]-2-aza-6-azoniatricyclo[4.2.1.03,7]nonane |
|---|---|
| PubChem CID | 11512739 |
| Molecular Formula | C24H30IN2+ |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (1R,3R,5R,7R)-5-(iodomethyl)-2,6-bis[(1S)-1-phenylethyl]-2-aza-6-azoniatricyclo[4.2.1.03,7]nonane |
| SMILES | C[C@@H](c1ccccc1)N1[C@@H]2C[C@@H]3[C@H]1C[C@H](CI)[N+]3([C@@H](C)c1ccccc1)C2 |
| InChI | InChI=1S/C24H30IN2/c1-17(19-9-5-3-6-10-19)26-21-13-24-23(26)14-22(15-25)27(24,16-21)18(2)20-11-7-4-8-12-20/h3-12,17-18,21-24H,13-16H2,1-2H3/q+1/t17-,18-,21+,22+,23+,24+,27?/m0/s1 |
| InChIKey | XPOSJKXJCOYPGD-FDJORTONSA-N |
| XLogP | 5.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|