About 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile
2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile (PubChem CID 115129421) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile.
Molecular Properties
| Compound Name | 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile |
| PubChem CID | 115129421 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile |
| SMILES | Cc1cc(C)c(CN(C)C(C)(C)C#N)c(C)c1 |
| InChI | InChI=1S/C15H22N2/c1-11-7-12(2)14(13(3)8-11)9-17(6)15(4,5)10-16/h7-8H,9H2,1-6H3 |
| InChIKey | MNSIMTYVRADUFN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile?
The IUPAC name of 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile (CID 115129421) is 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile.
What is the SMILES notation for 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile?
The canonical SMILES for 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile is Cc1cc(C)c(CN(C)C(C)(C)C#N)c(C)c1.
What is the InChIKey of 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile?
The InChIKey is MNSIMTYVRADUFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-11-7-12(2)14(13(3)8-11)9-17(6)15(4,5)10-16/h7-8H,9H2,1-6H3.
What are the key properties of 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile?
2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile has a molecular weight of 230.35 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[methyl-[(2,4,6-trimethylphenyl)methyl]amino]propanenitrile is sourced from PubChem (CID 115129421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).