C12H15ClN2O — CID 115130001
2-(5-chloro-2-methoxy-N,4-dimethylanilino)propanenitrile (PubChem CID 115130001) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N,4-dimethylanilino)propanenitrile.
| Compound Name | 2-(5-chloro-2-methoxy-N,4-dimethylanilino)propanenitrile |
|---|---|
| PubChem CID | 115130001 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N,4-dimethylanilino)propanenitrile |
| SMILES | COc1cc(C)c(Cl)cc1N(C)C(C)C#N |
| InChI | InChI=1S/C12H15ClN2O/c1-8-5-12(16-4)11(6-10(8)13)15(3)9(2)7-14/h5-6,9H,1-4H3 |
| InChIKey | YMQUQZLLPBEAFI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |