C12H19ClN2O — CID 115131795
2-N-(2-chloro-4-methoxyphenyl)-2-N,2-dimethylpropane-1,2-diamine (PubChem CID 115131795) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-N-(2-chloro-4-methoxyphenyl)-2-N,2-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-(2-chloro-4-methoxyphenyl)-2-N,2-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 115131795 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-N-(2-chloro-4-methoxyphenyl)-2-N,2-dimethylpropane-1,2-diamine |
| SMILES | COc1ccc(N(C)C(C)(C)CN)c(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2O/c1-12(2,8-14)15(3)11-6-5-9(16-4)7-10(11)13/h5-7H,8,14H2,1-4H3 |
| InChIKey | DBQAVHBWLFQYAV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|