C12H15ClN4O — CID 117038673
5-[(2-chloro-4-methoxy-N-methylanilino)methyl]-1H-pyrazol-3-amine (PubChem CID 117038673) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 5-[(2-chloro-4-methoxy-N-methylanilino)methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[(2-chloro-4-methoxy-N-methylanilino)methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117038673 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-[(2-chloro-4-methoxy-N-methylanilino)methyl]-1H-pyrazol-3-amine |
| SMILES | COc1ccc(N(C)Cc2cc(N)n[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClN4O/c1-17(7-8-5-12(14)16-15-8)11-4-3-9(18-2)6-10(11)13/h3-6H,7H2,1-2H3,(H3,14,15,16) |
| InChIKey | QBSSPLNMXJSIQB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|