C8H16N4 — CID 117038615
5-[[methyl(propan-2-yl)amino]methyl]-1H-pyrazol-3-amine (PubChem CID 117038615) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5-[[methyl(propan-2-yl)amino]methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[[methyl(propan-2-yl)amino]methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117038615 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 5-[[methyl(propan-2-yl)amino]methyl]-1H-pyrazol-3-amine |
| SMILES | CC(C)N(C)Cc1cc(N)n[nH]1 |
| InChI | InChI=1S/C8H16N4/c1-6(2)12(3)5-7-4-8(9)11-10-7/h4,6H,5H2,1-3H3,(H3,9,10,11) |
| InChIKey | MCZYEOQTLBRXRS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |