C10H20N4 — CID 117038793
5-[[methyl(pentyl)amino]methyl]-1H-pyrazol-3-amine (PubChem CID 117038793) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 5-[[methyl(pentyl)amino]methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[[methyl(pentyl)amino]methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117038793 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 5-[[methyl(pentyl)amino]methyl]-1H-pyrazol-3-amine |
| SMILES | CCCCCN(C)Cc1cc(N)n[nH]1 |
| InChI | InChI=1S/C10H20N4/c1-3-4-5-6-14(2)8-9-7-10(11)13-12-9/h7H,3-6,8H2,1-2H3,(H3,11,12,13) |
| InChIKey | GHQPRMGSNVYDBX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|