C12H17N5 — CID 117038825
5-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-pyrazol-3-amine (PubChem CID 117038825) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117038825 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 5-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1H-pyrazol-3-amine |
| SMILES | CN(CCc1ccccn1)Cc1cc(N)n[nH]1 |
| InChI | InChI=1S/C12H17N5/c1-17(9-11-8-12(13)16-15-11)7-5-10-4-2-3-6-14-10/h2-4,6,8H,5,7,9H2,1H3,(H3,13,15,16) |
| InChIKey | SKUJJZCAMKJGTM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |