C9H11BrN4S — CID 117038672
5-[[(4-bromothiophen-2-yl)-methylamino]methyl]-1H-pyrazol-3-amine (PubChem CID 117038672) has the molecular formula C9H11BrN4S and a molecular weight of 287.19 g/mol. Its IUPAC name is 5-[[(4-bromothiophen-2-yl)-methylamino]methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[[(4-bromothiophen-2-yl)-methylamino]methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117038672 |
| Molecular Formula | C9H11BrN4S |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 5-[[(4-bromothiophen-2-yl)-methylamino]methyl]-1H-pyrazol-3-amine |
| SMILES | CN(Cc1cc(N)n[nH]1)c1cc(Br)cs1 |
| InChI | InChI=1S/C9H11BrN4S/c1-14(9-2-6(10)5-15-9)4-7-3-8(11)13-12-7/h2-3,5H,4H2,1H3,(H3,11,12,13) |
| InChIKey | NOYUBLQAAXNPSI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |