C13H18N4 — CID 117038622
5-[(N,2,5-trimethylanilino)methyl]-1H-pyrazol-3-amine (PubChem CID 117038622) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-[(N,2,5-trimethylanilino)methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[(N,2,5-trimethylanilino)methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117038622 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 5-[(N,2,5-trimethylanilino)methyl]-1H-pyrazol-3-amine |
| SMILES | Cc1ccc(C)c(N(C)Cc2cc(N)n[nH]2)c1 |
| InChI | InChI=1S/C13H18N4/c1-9-4-5-10(2)12(6-9)17(3)8-11-7-13(14)16-15-11/h4-7H,8H2,1-3H3,(H3,14,15,16) |
| InChIKey | MNHPPAWLNILTKJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |