C8H13BrN2OS — CID 115121258
1-amino-3-[(4-bromothiophen-2-yl)-methylamino]propan-2-ol (PubChem CID 115121258) has the molecular formula C8H13BrN2OS and a molecular weight of 265.18 g/mol. Its IUPAC name is 1-amino-3-[(4-bromothiophen-2-yl)-methylamino]propan-2-ol.
| Compound Name | 1-amino-3-[(4-bromothiophen-2-yl)-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 115121258 |
| Molecular Formula | C8H13BrN2OS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 1-amino-3-[(4-bromothiophen-2-yl)-methylamino]propan-2-ol |
| SMILES | CN(CC(O)CN)c1cc(Br)cs1 |
| InChI | InChI=1S/C8H13BrN2OS/c1-11(4-7(12)3-10)8-2-6(9)5-13-8/h2,5,7,12H,3-4,10H2,1H3 |
| InChIKey | KXOCJBXBIKYBCZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |