C7H14N4 — CID 117215911
5-[(propan-2-ylamino)methyl]-1H-pyrazol-3-amine (PubChem CID 117215911) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 5-[(propan-2-ylamino)methyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[(propan-2-ylamino)methyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117215911 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 5-[(propan-2-ylamino)methyl]-1H-pyrazol-3-amine |
| SMILES | CC(C)NCc1cc(N)n[nH]1 |
| InChI | InChI=1S/C7H14N4/c1-5(2)9-4-6-3-7(8)11-10-6/h3,5,9H,4H2,1-2H3,(H3,8,10,11) |
| InChIKey | PGFGNSMAXUAHSK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |