C18H24N2 — CID 115134703
3-methyl-3-N-[(4-phenylphenyl)methyl]butane-1,3-diamine (PubChem CID 115134703) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-methyl-3-N-[(4-phenylphenyl)methyl]butane-1,3-diamine.
| Compound Name | 3-methyl-3-N-[(4-phenylphenyl)methyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 115134703 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3-methyl-3-N-[(4-phenylphenyl)methyl]butane-1,3-diamine |
| SMILES | CC(C)(CCN)NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N2/c1-18(2,12-13-19)20-14-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h3-11,20H,12-14,19H2,1-2H3 |
| InChIKey | GNRUOEGMAQYKNF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |