C19H17NO3 — CID 21321442
5-[(4-phenylphenyl)methylamino]benzene-1,2,3-triol (PubChem CID 21321442) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[(4-phenylphenyl)methylamino]benzene-1,2,3-triol.
| Compound Name | 5-[(4-phenylphenyl)methylamino]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 21321442 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 5-[(4-phenylphenyl)methylamino]benzene-1,2,3-triol |
| SMILES | Oc1cc(NCc2ccc(-c3ccccc3)cc2)cc(O)c1O |
| InChI | InChI=1S/C19H17NO3/c21-17-10-16(11-18(22)19(17)23)20-12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-11,20-23H,12H2 |
| InChIKey | ZBFYQSQQXBFIOI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|