C17H29NO — CID 115135445
2,2-dimethyl-3-[2-[4-(2-methylpropyl)phenyl]ethylamino]propan-1-ol (PubChem CID 115135445) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2,2-dimethyl-3-[2-[4-(2-methylpropyl)phenyl]ethylamino]propan-1-ol.
| Compound Name | 2,2-dimethyl-3-[2-[4-(2-methylpropyl)phenyl]ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 115135445 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2,2-dimethyl-3-[2-[4-(2-methylpropyl)phenyl]ethylamino]propan-1-ol |
| SMILES | CC(C)Cc1ccc(CCNCC(C)(C)CO)cc1 |
| InChI | InChI=1S/C17H29NO/c1-14(2)11-16-7-5-15(6-8-16)9-10-18-12-17(3,4)13-19/h5-8,14,18-19H,9-13H2,1-4H3 |
| InChIKey | JNMAQQKTUGCAPI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|