C15H25NOS — CID 115135480
3-[2-(4-ethylsulfanylphenyl)ethylamino]-2,2-dimethylpropan-1-ol (PubChem CID 115135480) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 3-[2-(4-ethylsulfanylphenyl)ethylamino]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[2-(4-ethylsulfanylphenyl)ethylamino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115135480 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-[2-(4-ethylsulfanylphenyl)ethylamino]-2,2-dimethylpropan-1-ol |
| SMILES | CCSc1ccc(CCNCC(C)(C)CO)cc1 |
| InChI | InChI=1S/C15H25NOS/c1-4-18-14-7-5-13(6-8-14)9-10-16-11-15(2,3)12-17/h5-8,16-17H,4,9-12H2,1-3H3 |
| InChIKey | OTHDNNMYZXAIAH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|