C13H14N2O4 — CID 115141454
2-[2-(1-methyl-2-oxo-3H-indol-5-yl)ethylamino]-2-oxoacetic acid (PubChem CID 115141454) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[2-(1-methyl-2-oxo-3H-indol-5-yl)ethylamino]-2-oxoacetic acid.
| Compound Name | 2-[2-(1-methyl-2-oxo-3H-indol-5-yl)ethylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 115141454 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[2-(1-methyl-2-oxo-3H-indol-5-yl)ethylamino]-2-oxoacetic acid |
| SMILES | CN1C(=O)Cc2cc(CCNC(=O)C(=O)O)ccc21 |
| InChI | InChI=1S/C13H14N2O4/c1-15-10-3-2-8(6-9(10)7-11(15)16)4-5-14-12(17)13(18)19/h2-3,6H,4-5,7H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | MNXAWSIJQFRSQY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|