C13H18N2OS — CID 115224218
1-methyl-5-[2-(2-sulfanylethylamino)ethyl]-3H-indol-2-one (PubChem CID 115224218) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-methyl-5-[2-(2-sulfanylethylamino)ethyl]-3H-indol-2-one.
| Compound Name | 1-methyl-5-[2-(2-sulfanylethylamino)ethyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 115224218 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-methyl-5-[2-(2-sulfanylethylamino)ethyl]-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(CCNCCS)ccc21 |
| InChI | InChI=1S/C13H18N2OS/c1-15-12-3-2-10(4-5-14-6-7-17)8-11(12)9-13(15)16/h2-3,8,14,17H,4-7,9H2,1H3 |
| InChIKey | IVLBINOZXLTGPH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|