C12H15NO2S — CID 11514209
2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfinyl)acetamide (PubChem CID 11514209) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfinyl)acetamide.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfinyl)acetamide |
|---|---|
| PubChem CID | 11514209 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfinyl)acetamide |
| SMILES | NC(=O)CS(=O)C1CCCc2ccccc21 |
| InChI | InChI=1S/C12H15NO2S/c13-12(14)8-16(15)11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,11H,3,5,7-8H2,(H2,13,14) |
| InChIKey | YBPVBTJGDRCRTD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |