C14H25N5 — CID 115145014
4-N-(2,2-dimethylbutyl)-2-N-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine (PubChem CID 115145014) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 4-N-(2,2-dimethylbutyl)-2-N-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,2-dimethylbutyl)-2-N-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 115145014 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 4-N-(2,2-dimethylbutyl)-2-N-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4-diamine |
| SMILES | CCC(C)(C)CNc1nc(NC)nc2c1CNCC2 |
| InChI | InChI=1S/C14H25N5/c1-5-14(2,3)9-17-12-10-8-16-7-6-11(10)18-13(15-4)19-12/h16H,5-9H2,1-4H3,(H2,15,17,18,19) |
| InChIKey | YIVKTMFHBHEDJR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |