C14H21N5 — CID 115145137
4-(4-methylpentylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-carbonitrile (PubChem CID 115145137) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 4-(4-methylpentylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-carbonitrile.
| Compound Name | 4-(4-methylpentylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 115145137 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-(4-methylpentylamino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-carbonitrile |
| SMILES | CC(C)CCCNc1nc(C#N)nc2c1CNCC2 |
| InChI | InChI=1S/C14H21N5/c1-10(2)4-3-6-17-14-11-9-16-7-5-12(11)18-13(8-15)19-14/h10,16H,3-7,9H2,1-2H3,(H,17,18,19) |
| InChIKey | VRTXHQHJTPIYJK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|