C17H15N3 — CID 115146365
2-(N,3-dimethylanilino)-1H-indole-3-carbonitrile (PubChem CID 115146365) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-(N,3-dimethylanilino)-1H-indole-3-carbonitrile.
| Compound Name | 2-(N,3-dimethylanilino)-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 115146365 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-(N,3-dimethylanilino)-1H-indole-3-carbonitrile |
| SMILES | Cc1cccc(N(C)c2[nH]c3ccccc3c2C#N)c1 |
| InChI | InChI=1S/C17H15N3/c1-12-6-5-7-13(10-12)20(2)17-15(11-18)14-8-3-4-9-16(14)19-17/h3-10,19H,1-2H3 |
| InChIKey | MDUKXEUTLYIDRE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |