C16H13F3N2 — CID 63510824
4-(N,3-dimethylanilino)-2-(trifluoromethyl)benzonitrile (PubChem CID 63510824) has the molecular formula C16H13F3N2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-(N,3-dimethylanilino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(N,3-dimethylanilino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 63510824 |
| Molecular Formula | C16H13F3N2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-(N,3-dimethylanilino)-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cccc(N(C)c2ccc(C#N)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H13F3N2/c1-11-4-3-5-13(8-11)21(2)14-7-6-12(10-20)15(9-14)16(17,18)19/h3-9H,1-2H3 |
| InChIKey | IFWBFSJKDSTXQZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |