C15H13N3O2 — CID 115501146
5-(N,3-dimethylanilino)-2-nitrobenzonitrile (PubChem CID 115501146) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 5-(N,3-dimethylanilino)-2-nitrobenzonitrile.
| Compound Name | 5-(N,3-dimethylanilino)-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 115501146 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-(N,3-dimethylanilino)-2-nitrobenzonitrile |
| SMILES | Cc1cccc(N(C)c2ccc([N+](=O)[O-])c(C#N)c2)c1 |
| InChI | InChI=1S/C15H13N3O2/c1-11-4-3-5-13(8-11)17(2)14-6-7-15(18(19)20)12(9-14)10-16/h3-9H,1-2H3 |
| InChIKey | SKCULUUOUOUUGT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|