C15H11Cl2N3O2 — CID 125469507
5-[(3,4-dichlorophenyl)methyl-methylamino]-2-nitrobenzonitrile (PubChem CID 125469507) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methyl-methylamino]-2-nitrobenzonitrile.
| Compound Name | 5-[(3,4-dichlorophenyl)methyl-methylamino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 125469507 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methyl-methylamino]-2-nitrobenzonitrile |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)c1ccc([N+](=O)[O-])c(C#N)c1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c1-19(9-10-2-4-13(16)14(17)6-10)12-3-5-15(20(21)22)11(7-12)8-18/h2-7H,9H2,1H3 |
| InChIKey | ZDKWRHOIMBICMK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|