C16H23N5O3 — CID 86805517
5-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]-2-nitrobenzonitrile (PubChem CID 86805517) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]-2-nitrobenzonitrile.
| Compound Name | 5-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 86805517 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 5-[[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]-methylamino]-2-nitrobenzonitrile |
| SMILES | CN1CCN(CC(O)CN(C)c2ccc([N+](=O)[O-])c(C#N)c2)CC1 |
| InChI | InChI=1S/C16H23N5O3/c1-18-5-7-20(8-6-18)12-15(22)11-19(2)14-3-4-16(21(23)24)13(9-14)10-17/h3-4,9,15,22H,5-8,11-12H2,1-2H3 |
| InChIKey | YJFOEGBARKORBD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|