C14H25N3 — CID 115147791
6-methyl-2-N-(2,2,4-trimethylpentyl)pyridine-2,5-diamine (PubChem CID 115147791) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-methyl-2-N-(2,2,4-trimethylpentyl)pyridine-2,5-diamine.
| Compound Name | 6-methyl-2-N-(2,2,4-trimethylpentyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 115147791 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 6-methyl-2-N-(2,2,4-trimethylpentyl)pyridine-2,5-diamine |
| SMILES | Cc1nc(NCC(C)(C)CC(C)C)ccc1N |
| InChI | InChI=1S/C14H25N3/c1-10(2)8-14(4,5)9-16-13-7-6-12(15)11(3)17-13/h6-7,10H,8-9,15H2,1-5H3,(H,16,17) |
| InChIKey | PSCDOCGPERYWSA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |