C15H24BNO4 — CID 11514830
[2-[[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid (PubChem CID 11514830) has the molecular formula C15H24BNO4 and a molecular weight of 293.17 g/mol. Its IUPAC name is [2-[[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-[[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 11514830 |
| Molecular Formula | C15H24BNO4 |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | [2-[[(2S,5S)-2,5-bis(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid |
| SMILES | COC[C@@H]1CC[C@@H](COC)N1Cc1ccccc1B(O)O |
| InChI | InChI=1S/C15H24BNO4/c1-20-10-13-7-8-14(11-21-2)17(13)9-12-5-3-4-6-15(12)16(18)19/h3-6,13-14,18-19H,7-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | XRGLTKKKHODKAQ-KBPBESRZSA-N |
| XLogP | -0.01 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|