C15H19BrN2S — CID 115148718
5-bromo-3-methyl-N-[2-methyl-2-(3-methylthiophen-2-yl)propyl]pyridin-2-amine (PubChem CID 115148718) has the molecular formula C15H19BrN2S and a molecular weight of 339.30 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[2-methyl-2-(3-methylthiophen-2-yl)propyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-methyl-N-[2-methyl-2-(3-methylthiophen-2-yl)propyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115148718 |
| Molecular Formula | C15H19BrN2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-bromo-3-methyl-N-[2-methyl-2-(3-methylthiophen-2-yl)propyl]pyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1NCC(C)(C)c1sccc1C |
| InChI | InChI=1S/C15H19BrN2S/c1-10-5-6-19-13(10)15(3,4)9-18-14-11(2)7-12(16)8-17-14/h5-8H,9H2,1-4H3,(H,17,18) |
| InChIKey | BFIHZHHGAXUSTQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |