C12H21N3 — CID 115149878
4-N-[2-(1H-pyrrol-3-yl)ethyl]cyclohexane-1,4-diamine (PubChem CID 115149878) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-N-[2-(1H-pyrrol-3-yl)ethyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[2-(1H-pyrrol-3-yl)ethyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 115149878 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 4-N-[2-(1H-pyrrol-3-yl)ethyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCCc2cc[nH]c2)CC1 |
| InChI | InChI=1S/C12H21N3/c13-11-1-3-12(4-2-11)15-8-6-10-5-7-14-9-10/h5,7,9,11-12,14-15H,1-4,6,8,13H2 |
| InChIKey | NMWRYCAOPKSXPI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |