C17H23NO4 — CID 11515026
(3R,4S,5S,6S,8R)-4-hydroxy-3-methyl-8-phenyl-6-propan-2-yl-7,9-dioxa-1-azaspiro[4.5]decan-2-one (PubChem CID 11515026) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (3R,4S,5S,6S,8R)-4-hydroxy-3-methyl-8-phenyl-6-propan-2-yl-7,9-dioxa-1-azaspiro[4.5]decan-2-one.
| Compound Name | (3R,4S,5S,6S,8R)-4-hydroxy-3-methyl-8-phenyl-6-propan-2-yl-7,9-dioxa-1-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 11515026 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (3R,4S,5S,6S,8R)-4-hydroxy-3-methyl-8-phenyl-6-propan-2-yl-7,9-dioxa-1-azaspiro[4.5]decan-2-one |
| SMILES | CC(C)[C@@H]1O[C@H](c2ccccc2)OC[C@@]12NC(=O)[C@H](C)[C@@H]2O |
| InChI | InChI=1S/C17H23NO4/c1-10(2)14-17(13(19)11(3)15(20)18-17)9-21-16(22-14)12-7-5-4-6-8-12/h4-8,10-11,13-14,16,19H,9H2,1-3H3,(H,18,20)/t11-,13+,14+,16-,17+/m1/s1 |
| InChIKey | IALAOYKQTIKOOJ-VJOHVRBBSA-N |
| XLogP | 1.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |