C16H20N4 — CID 115150262
4-[2-(3H-benzimidazol-5-yl)ethylamino]cyclohexane-1-carbonitrile (PubChem CID 115150262) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[2-(3H-benzimidazol-5-yl)ethylamino]cyclohexane-1-carbonitrile.
| Compound Name | 4-[2-(3H-benzimidazol-5-yl)ethylamino]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 115150262 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-[2-(3H-benzimidazol-5-yl)ethylamino]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(NCCc2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C16H20N4/c17-10-13-1-4-14(5-2-13)18-8-7-12-3-6-15-16(9-12)20-11-19-15/h3,6,9,11,13-14,18H,1-2,4-5,7-8H2,(H,19,20) |
| InChIKey | MARGQVJWIZMCJF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |