C14H28N2O2 — CID 115151450
4-amino-4-(hydroxymethyl)-N-(4-methylpentyl)cyclohexane-1-carboxamide (PubChem CID 115151450) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-amino-4-(hydroxymethyl)-N-(4-methylpentyl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-4-(hydroxymethyl)-N-(4-methylpentyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115151450 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 4-amino-4-(hydroxymethyl)-N-(4-methylpentyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)CCCNC(=O)C1CCC(N)(CO)CC1 |
| InChI | InChI=1S/C14H28N2O2/c1-11(2)4-3-9-16-13(18)12-5-7-14(15,10-17)8-6-12/h11-12,17H,3-10,15H2,1-2H3,(H,16,18) |
| InChIKey | GXIZPKVTASROMT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|