C12H15N3O3 — CID 115151571
4-(2-aminoacetyl)-2-methyl-6-(methylamino)-1,4-benzoxazin-3-one (PubChem CID 115151571) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-(2-aminoacetyl)-2-methyl-6-(methylamino)-1,4-benzoxazin-3-one.
| Compound Name | 4-(2-aminoacetyl)-2-methyl-6-(methylamino)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115151571 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-(2-aminoacetyl)-2-methyl-6-(methylamino)-1,4-benzoxazin-3-one |
| SMILES | CNc1ccc2c(c1)N(C(=O)CN)C(=O)C(C)O2 |
| InChI | InChI=1S/C12H15N3O3/c1-7-12(17)15(11(16)6-13)9-5-8(14-2)3-4-10(9)18-7/h3-5,7,14H,6,13H2,1-2H3 |
| InChIKey | GSZSMVYZYPOQBX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|