C12H14N2O3S — CID 115167767
6-(methylamino)-4-(3-sulfanylpropanoyl)-1,4-benzoxazin-3-one (PubChem CID 115167767) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 6-(methylamino)-4-(3-sulfanylpropanoyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(methylamino)-4-(3-sulfanylpropanoyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115167767 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 6-(methylamino)-4-(3-sulfanylpropanoyl)-1,4-benzoxazin-3-one |
| SMILES | CNc1ccc2c(c1)N(C(=O)CCS)C(=O)CO2 |
| InChI | InChI=1S/C12H14N2O3S/c1-13-8-2-3-10-9(6-8)14(11(15)4-5-18)12(16)7-17-10/h2-3,6,13,18H,4-5,7H2,1H3 |
| InChIKey | INNCXIDTUVIHAW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|