C11H11F3N2O2 — CID 115257791
6-(methylamino)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one (PubChem CID 115257791) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 6-(methylamino)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(methylamino)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115257791 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-(methylamino)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one |
| SMILES | CNc1ccc2c(c1)N(CC(F)(F)F)C(=O)CO2 |
| InChI | InChI=1S/C11H11F3N2O2/c1-15-7-2-3-9-8(4-7)16(6-11(12,13)14)10(17)5-18-9/h2-4,15H,5-6H2,1H3 |
| InChIKey | GZYUOMLFRUDBNA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|