C20H34O4 — CID 11515597
diethyl (4E)-cyclotetradec-4-ene-1,1-dicarboxylate (PubChem CID 11515597) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is diethyl (4E)-cyclotetradec-4-ene-1,1-dicarboxylate.
| Compound Name | diethyl (4E)-cyclotetradec-4-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11515597 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | diethyl (4E)-cyclotetradec-4-ene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC/C=C/CCCCCCCCC1 |
| InChI | InChI=1S/C20H34O4/c1-3-23-18(21)20(19(22)24-4-2)16-14-12-10-8-6-5-7-9-11-13-15-17-20/h10,12H,3-9,11,13-17H2,1-2H3/b12-10+ |
| InChIKey | XSXNUWUPRWZNEB-ZRDIBKRKSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|